C19H18O2S — CID 132501403
ethyl (2Z,4E)-5-phenyl-3-phenylsulfanylpenta-2,4-dienoate (PubChem CID 132501403) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is ethyl (2Z,4E)-5-phenyl-3-phenylsulfanylpenta-2,4-dienoate.
| Compound Name | ethyl (2Z,4E)-5-phenyl-3-phenylsulfanylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 132501403 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | ethyl (2Z,4E)-5-phenyl-3-phenylsulfanylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(/C=C/c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C19H18O2S/c1-2-21-19(20)15-18(22-17-11-7-4-8-12-17)14-13-16-9-5-3-6-10-16/h3-15H,2H2,1H3/b14-13+,18-15- |
| InChIKey | DCLFTYULYANEFA-JRDADBJUSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|