C21H21NO6S — CID 122222029
ethyl (2E,4E)-5-(3,4-dimethoxyphenyl)-3-(4-nitrophenyl)sulfanylpenta-2,4-dienoate (PubChem CID 122222029) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(3,4-dimethoxyphenyl)-3-(4-nitrophenyl)sulfanylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(3,4-dimethoxyphenyl)-3-(4-nitrophenyl)sulfanylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 122222029 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | ethyl (2E,4E)-5-(3,4-dimethoxyphenyl)-3-(4-nitrophenyl)sulfanylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C=C(\C=C\c1ccc(OC)c(OC)c1)Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21NO6S/c1-4-28-21(23)14-18(29-17-10-7-16(8-11-17)22(24)25)9-5-15-6-12-19(26-2)20(13-15)27-3/h5-14H,4H2,1-3H3/b9-5+,18-14+ |
| InChIKey | ITCSLPXFGQZRSA-GDMWAGRSSA-N |
| XLogP | 4.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|