C22H22N2O10 — CID 122365383
ethyl 3-hydroxy-2-[[(E)-3-[3-methoxy-4-(4-nitrophenoxy)carbonyloxyphenyl]prop-2-enoyl]amino]propanoate (PubChem CID 122365383) has the molecular formula C22H22N2O10 and a molecular weight of 474.42 g/mol. Its IUPAC name is ethyl 3-hydroxy-2-[[(E)-3-[3-methoxy-4-(4-nitrophenoxy)carbonyloxyphenyl]prop-2-enoyl]amino]propanoate.
| Compound Name | ethyl 3-hydroxy-2-[[(E)-3-[3-methoxy-4-(4-nitrophenoxy)carbonyloxyphenyl]prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 122365383 |
| Molecular Formula | C22H22N2O10 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | ethyl 3-hydroxy-2-[[(E)-3-[3-methoxy-4-(4-nitrophenoxy)carbonyloxyphenyl]prop-2-enoyl]amino]propanoate |
| SMILES | CCOC(=O)C(CO)NC(=O)/C=C/c1ccc(OC(=O)Oc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O10/c1-3-32-21(27)17(13-25)23-20(26)11-5-14-4-10-18(19(12-14)31-2)34-22(28)33-16-8-6-15(7-9-16)24(29)30/h4-12,17,25H,3,13H2,1-2H3,(H,23,26)/b11-5+ |
| InChIKey | VVIIHRMKHAVDBZ-VZUCSPMQSA-N |
| XLogP | 2.23 |
| TPSA | 163.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|