C15H18S — CID 122386012
[(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene (PubChem CID 122386012) has the molecular formula C15H18S and a molecular weight of 230.38 g/mol. Its IUPAC name is [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene.
| Compound Name | [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene |
|---|---|
| PubChem CID | 122386012 |
| Molecular Formula | C15H18S |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene |
| SMILES | C=CCC(=C/SCC)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H18S/c1-3-8-15(13-16-4-2)12-11-14-9-6-5-7-10-14/h3,5-7,9-13H,1,4,8H2,2H3/b12-11+,15-13- |
| InChIKey | DJSASXYZBGRFTI-UDPMFAINSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|