About [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene
[(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene (PubChem CID 122386012) has the molecular formula C15H18S
and a molecular weight of 230.38 g/mol. Its IUPAC name is [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene.
Molecular Properties
| Compound Name | [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene |
| PubChem CID | 122386012 |
| Molecular Formula | C15H18S |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene |
| SMILES | C=CCC(=C/SCC)/C=C/c1ccccc1 |
| InChI | InChI=1S/C15H18S/c1-3-8-15(13-16-4-2)12-11-14-9-6-5-7-10-14/h3,5-7,9-13H,1,4,8H2,2H3/b12-11+,15-13- |
| InChIKey | DJSASXYZBGRFTI-UDPMFAINSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene?
The IUPAC name of [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene (CID 122386012) is [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene.
What is the SMILES notation for [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene?
The canonical SMILES for [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene is C=CCC(=C/SCC)/C=C/c1ccccc1.
What is the InChIKey of [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene?
The InChIKey is DJSASXYZBGRFTI-UDPMFAINSA-N. The full InChI is InChI=1S/C15H18S/c1-3-8-15(13-16-4-2)12-11-14-9-6-5-7-10-14/h3,5-7,9-13H,1,4,8H2,2H3/b12-11+,15-13-.
What are the key properties of [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene?
[(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene has a molecular weight of 230.38 g/mol, XLogP of 4.91, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3Z)-3-(ethylsulfanylmethylidene)hexa-1,5-dienyl]benzene is sourced from PubChem (CID 122386012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).