C17H15NO2 — CID 173095645
N-hydroxy-5-(2-phenylphenyl)penta-2,4-dienamide (PubChem CID 173095645) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-hydroxy-5-(2-phenylphenyl)penta-2,4-dienamide.
| Compound Name | N-hydroxy-5-(2-phenylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 173095645 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-hydroxy-5-(2-phenylphenyl)penta-2,4-dienamide |
| SMILES | O=C(C=CC=Cc1ccccc1-c1ccccc1)NO |
| InChI | InChI=1S/C17H15NO2/c19-17(18-20)13-7-5-11-15-10-4-6-12-16(15)14-8-2-1-3-9-14/h1-13,20H,(H,18,19) |
| InChIKey | CECOYUIBCKZONA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|