C21H18O2S2 — CID 5075260
2-(1,3-dithiolan-2-ylidene)-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione (PubChem CID 5075260) has the molecular formula C21H18O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-ylidene)-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione.
| Compound Name | 2-(1,3-dithiolan-2-ylidene)-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 5075260 |
| Molecular Formula | C21H18O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-(1,3-dithiolan-2-ylidene)-5-(4-methylphenyl)-1-phenylpent-4-ene-1,3-dione |
| SMILES | Cc1ccc(C=CC(=O)C(C(=O)c2ccccc2)=C2SCCS2)cc1 |
| InChI | InChI=1S/C21H18O2S2/c1-15-7-9-16(10-8-15)11-12-18(22)19(21-24-13-14-25-21)20(23)17-5-3-2-4-6-17/h2-12H,13-14H2,1H3 |
| InChIKey | MNUCOEPRCPNZNX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|