C12H12OS2 — CID 125483616
2-(1,3-dithiolan-2-ylidene)-1-phenylpropan-1-one (PubChem CID 125483616) has the molecular formula C12H12OS2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-ylidene)-1-phenylpropan-1-one.
| Compound Name | 2-(1,3-dithiolan-2-ylidene)-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 125483616 |
| Molecular Formula | C12H12OS2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 2-(1,3-dithiolan-2-ylidene)-1-phenylpropan-1-one |
| SMILES | CC(C(=O)c1ccccc1)=C1SCCS1 |
| InChI | InChI=1S/C12H12OS2/c1-9(12-14-7-8-15-12)11(13)10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| InChIKey | CSVVJYICHHZEFD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|