C14H11ClO3S2 — CID 15112298
(E)-5-(2-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enoic acid (PubChem CID 15112298) has the molecular formula C14H11ClO3S2 and a molecular weight of 326.83 g/mol. Its IUPAC name is (E)-5-(2-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enoic acid.
| Compound Name | (E)-5-(2-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enoic acid |
|---|---|
| PubChem CID | 15112298 |
| Molecular Formula | C14H11ClO3S2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 325.98 |
| IUPAC Name | (E)-5-(2-chlorophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enoic acid |
| SMILES | O=C(O)C(C(=O)/C=C/c1ccccc1Cl)=C1SCCS1 |
| InChI | InChI=1S/C14H11ClO3S2/c15-10-4-2-1-3-9(10)5-6-11(16)12(13(17)18)14-19-7-8-20-14/h1-6H,7-8H2,(H,17,18)/b6-5+ |
| InChIKey | DLOJHBHUXMVYFM-AATRIKPKSA-N |
| XLogP | 3.70 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|