C14H14O3S3 — CID 6247016
(E)-2-(1,3-dithiepan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enoic acid (PubChem CID 6247016) has the molecular formula C14H14O3S3 and a molecular weight of 326.46 g/mol. Its IUPAC name is (E)-2-(1,3-dithiepan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enoic acid.
| Compound Name | (E)-2-(1,3-dithiepan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enoic acid |
|---|---|
| PubChem CID | 6247016 |
| Molecular Formula | C14H14O3S3 |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | (E)-2-(1,3-dithiepan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enoic acid |
| SMILES | O=C(O)C(C(=O)/C=C/c1cccs1)=C1SCCCCS1 |
| InChI | InChI=1S/C14H14O3S3/c15-11(6-5-10-4-3-9-18-10)12(13(16)17)14-19-7-1-2-8-20-14/h3-6,9H,1-2,7-8H2,(H,16,17)/b6-5+ |
| InChIKey | NINXYAFADHDXKV-AATRIKPKSA-N |
| XLogP | 3.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|