C12H9NOS3 — CID 102424252
(E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enenitrile (PubChem CID 102424252) has the molecular formula C12H9NOS3 and a molecular weight of 279.41 g/mol. Its IUPAC name is (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enenitrile.
| Compound Name | (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enenitrile |
|---|---|
| PubChem CID | 102424252 |
| Molecular Formula | C12H9NOS3 |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-thiophen-2-ylpent-4-enenitrile |
| SMILES | N#CC(C(=O)/C=C/c1cccs1)=C1SCCS1 |
| InChI | InChI=1S/C12H9NOS3/c13-8-10(12-16-6-7-17-12)11(14)4-3-9-2-1-5-15-9/h1-5H,6-7H2/b4-3+ |
| InChIKey | IWEUWOABJKBEBS-ONEGZZNKSA-N |
| XLogP | 3.55 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|