C14H10BrNOS2 — CID 42624952
(E)-5-(4-bromophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enenitrile (PubChem CID 42624952) has the molecular formula C14H10BrNOS2 and a molecular weight of 352.28 g/mol. Its IUPAC name is (E)-5-(4-bromophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enenitrile.
| Compound Name | (E)-5-(4-bromophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enenitrile |
|---|---|
| PubChem CID | 42624952 |
| Molecular Formula | C14H10BrNOS2 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 350.94 |
| IUPAC Name | (E)-5-(4-bromophenyl)-2-(1,3-dithiolan-2-ylidene)-3-oxopent-4-enenitrile |
| SMILES | N#CC(C(=O)/C=C/c1ccc(Br)cc1)=C1SCCS1 |
| InChI | InChI=1S/C14H10BrNOS2/c15-11-4-1-10(2-5-11)3-6-13(17)12(9-16)14-18-7-8-19-14/h1-6H,7-8H2/b6-3+ |
| InChIKey | ZLNWMNNPWZFRQB-ZZXKWVIFSA-N |
| XLogP | 4.25 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|