C14H11NOS2 — CID 102424246
(E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-phenylpent-4-enenitrile (PubChem CID 102424246) has the molecular formula C14H11NOS2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-phenylpent-4-enenitrile.
| Compound Name | (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-phenylpent-4-enenitrile |
|---|---|
| PubChem CID | 102424246 |
| Molecular Formula | C14H11NOS2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (E)-2-(1,3-dithiolan-2-ylidene)-3-oxo-5-phenylpent-4-enenitrile |
| SMILES | N#CC(C(=O)/C=C/c1ccccc1)=C1SCCS1 |
| InChI | InChI=1S/C14H11NOS2/c15-10-12(14-17-8-9-18-14)13(16)7-6-11-4-2-1-3-5-11/h1-7H,8-9H2/b7-6+ |
| InChIKey | GUUIXVZPIAUSBB-VOTSOKGWSA-N |
| XLogP | 3.48 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|