C27H30N2O2S2 — CID 3671002
1,7-bis[4-(dimethylamino)phenyl]-4-(1,3-dithian-2-ylidene)hepta-1,6-diene-3,5-dione (PubChem CID 3671002) has the molecular formula C27H30N2O2S2 and a molecular weight of 478.68 g/mol. Its IUPAC name is 1,7-bis[4-(dimethylamino)phenyl]-4-(1,3-dithian-2-ylidene)hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis[4-(dimethylamino)phenyl]-4-(1,3-dithian-2-ylidene)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 3671002 |
| Molecular Formula | C27H30N2O2S2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 1,7-bis[4-(dimethylamino)phenyl]-4-(1,3-dithian-2-ylidene)hepta-1,6-diene-3,5-dione |
| SMILES | CN(C)c1ccc(C=CC(=O)C(C(=O)C=Cc2ccc(N(C)C)cc2)=C2SCCCS2)cc1 |
| InChI | InChI=1S/C27H30N2O2S2/c1-28(2)22-12-6-20(7-13-22)10-16-24(30)26(27-32-18-5-19-33-27)25(31)17-11-21-8-14-23(15-9-21)29(3)4/h6-17H,5,18-19H2,1-4H3 |
| InChIKey | BQTUFCLXOJIUQQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|