C16H18NNaO2S2 — CID 102153888
sodium (E)-5-[4-(dimethylamino)phenyl]-2-(1,3-dithiolan-2-ylidene)pent-4-enoate (PubChem CID 102153888) has the molecular formula C16H18NNaO2S2 and a molecular weight of 343.45 g/mol. Its IUPAC name is sodium (E)-5-[4-(dimethylamino)phenyl]-2-(1,3-dithiolan-2-ylidene)pent-4-enoate.
| Compound Name | sodium (E)-5-[4-(dimethylamino)phenyl]-2-(1,3-dithiolan-2-ylidene)pent-4-enoate |
|---|---|
| PubChem CID | 102153888 |
| Molecular Formula | C16H18NNaO2S2 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | sodium (E)-5-[4-(dimethylamino)phenyl]-2-(1,3-dithiolan-2-ylidene)pent-4-enoate |
| SMILES | CN(C)c1ccc(/C=C/CC(C(=O)[O-])=C2SCCS2)cc1.[Na+] |
| InChI | InChI=1S/C16H19NO2S2.Na/c1-17(2)13-8-6-12(7-9-13)4-3-5-14(15(18)19)16-20-10-11-21-16;/h3-4,6-9H,5,10-11H2,1-2H3,(H,18,19);/q;+1/p-1/b4-3+; |
| InChIKey | FCRZMZDRYJLQLE-BJILWQEISA-M |
| XLogP | -0.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|