C15H14O3S2 — CID 93003216
(Z,2Z)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxo-5-phenylpent-4-enoic acid (PubChem CID 93003216) has the molecular formula C15H14O3S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is (Z,2Z)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxo-5-phenylpent-4-enoic acid.
| Compound Name | (Z,2Z)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxo-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 93003216 |
| Molecular Formula | C15H14O3S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (Z,2Z)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxo-5-phenylpent-4-enoic acid |
| SMILES | C[C@@H]1CS/C(=C(/C(=O)O)C(=O)/C=C\c2ccccc2)S1 |
| InChI | InChI=1S/C15H14O3S2/c1-10-9-19-15(20-10)13(14(17)18)12(16)8-7-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,17,18)/b8-7-,15-13-/t10-/m1/s1 |
| InChIKey | MQPFPMFLYICOQL-UIFNXEOISA-N |
| XLogP | 3.43 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|