C13H12O4S2 — CID 40543144
(E,2E)-5-(furan-2-yl)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxopent-4-enoic acid (PubChem CID 40543144) has the molecular formula C13H12O4S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (E,2E)-5-(furan-2-yl)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxopent-4-enoic acid.
| Compound Name | (E,2E)-5-(furan-2-yl)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxopent-4-enoic acid |
|---|---|
| PubChem CID | 40543144 |
| Molecular Formula | C13H12O4S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (E,2E)-5-(furan-2-yl)-2-[(4R)-4-methyl-1,3-dithiolan-2-ylidene]-3-oxopent-4-enoic acid |
| SMILES | C[C@@H]1CS/C(=C(\C(=O)O)C(=O)/C=C/c2ccco2)S1 |
| InChI | InChI=1S/C13H12O4S2/c1-8-7-18-13(19-8)11(12(15)16)10(14)5-4-9-3-2-6-17-9/h2-6,8H,7H2,1H3,(H,15,16)/b5-4+,13-11+/t8-/m1/s1 |
| InChIKey | WPIBQCLJOVBCHF-VXPTZCRDSA-N |
| XLogP | 3.03 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|