C25H24O4S2 — CID 3356810
1,7-bis(4-methoxyphenyl)-4-(4-methyl-1,3-dithiolan-2-ylidene)hepta-1,6-diene-3,5-dione (PubChem CID 3356810) has the molecular formula C25H24O4S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is 1,7-bis(4-methoxyphenyl)-4-(4-methyl-1,3-dithiolan-2-ylidene)hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis(4-methoxyphenyl)-4-(4-methyl-1,3-dithiolan-2-ylidene)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 3356810 |
| Molecular Formula | C25H24O4S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1,7-bis(4-methoxyphenyl)-4-(4-methyl-1,3-dithiolan-2-ylidene)hepta-1,6-diene-3,5-dione |
| SMILES | COc1ccc(C=CC(=O)C(C(=O)C=Cc2ccc(OC)cc2)=C2SCC(C)S2)cc1 |
| InChI | InChI=1S/C25H24O4S2/c1-17-16-30-25(31-17)24(22(26)14-8-18-4-10-20(28-2)11-5-18)23(27)15-9-19-6-12-21(29-3)13-7-19/h4-15,17H,16H2,1-3H3 |
| InChIKey | IJFVHMBADWEQIX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|