C15H15NO6 — CID 102175549
ethyl (Z)-2-hydroxy-3-nitro-4-(2-prop-2-ynoxyphenyl)but-3-enoate (PubChem CID 102175549) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is ethyl (Z)-2-hydroxy-3-nitro-4-(2-prop-2-ynoxyphenyl)but-3-enoate.
| Compound Name | ethyl (Z)-2-hydroxy-3-nitro-4-(2-prop-2-ynoxyphenyl)but-3-enoate |
|---|---|
| PubChem CID | 102175549 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | ethyl (Z)-2-hydroxy-3-nitro-4-(2-prop-2-ynoxyphenyl)but-3-enoate |
| SMILES | C#CCOc1ccccc1/C=C(/C(O)C(=O)OCC)[N+](=O)[O-] |
| InChI | InChI=1S/C15H15NO6/c1-3-9-22-13-8-6-5-7-11(13)10-12(16(19)20)14(17)15(18)21-4-2/h1,5-8,10,14,17H,4,9H2,2H3/b12-10- |
| InChIKey | DDQJBFWOBKPNRI-BENRWUELSA-N |
| XLogP | 1.24 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|