C10H10O3 — CID 15757941
2-ethoxybenzene-1,3-dicarbaldehyde (PubChem CID 15757941) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-ethoxybenzene-1,3-dicarbaldehyde.
| Compound Name | 2-ethoxybenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 15757941 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2-ethoxybenzene-1,3-dicarbaldehyde |
| SMILES | CCOc1c(C=O)cccc1C=O |
| InChI | InChI=1S/C10H10O3/c1-2-13-10-8(6-11)4-3-5-9(10)7-12/h3-7H,2H2,1H3 |
| InChIKey | JYZBQPJFHUPZSR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|