C24H36O12S2 — CID 139335958
3-[2-[2-[3-[2-[2-(3-sulfopropoxy)ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]propane-1-sulfonic acid (PubChem CID 139335958) has the molecular formula C24H36O12S2 and a molecular weight of 580.67 g/mol. Its IUPAC name is 3-[2-[2-[3-[2-[2-(3-sulfopropoxy)ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-[2-[3-[2-[2-(3-sulfopropoxy)ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 139335958 |
| Molecular Formula | C24H36O12S2 |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | 3-[2-[2-[3-[2-[2-(3-sulfopropoxy)ethoxy]ethoxy]naphthalen-2-yl]oxyethoxy]ethoxy]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCOCCOCCOc1cc2ccccc2cc1OCCOCCOCCCS(=O)(=O)O |
| InChI | InChI=1S/C24H36O12S2/c25-37(26,27)17-3-7-31-9-11-33-13-15-35-23-19-21-5-1-2-6-22(21)20-24(23)36-16-14-34-12-10-32-8-4-18-38(28,29)30/h1-2,5-6,19-20H,3-4,7-18H2,(H,25,26,27)(H,28,29,30) |
| InChIKey | XPVNIULIKSUDHK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|