C24H40K2O14S2 — CID 154628159
dipotassium;3-[2-[2-[2-[2-[2-[2-[2-(3-sulfonatopropoxy)ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]propane-1-sulfonate (PubChem CID 154628159) has the molecular formula C24H40K2O14S2 and a molecular weight of 694.90 g/mol. Its IUPAC name is dipotassium;3-[2-[2-[2-[2-[2-[2-[2-(3-sulfonatopropoxy)ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]propane-1-sulfonate.
| Compound Name | dipotassium;3-[2-[2-[2-[2-[2-[2-[2-(3-sulfonatopropoxy)ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 154628159 |
| Molecular Formula | C24H40K2O14S2 |
| Molecular Weight | 694.90 g/mol |
| Exact Mass | 694.11 |
| IUPAC Name | dipotassium;3-[2-[2-[2-[2-[2-[2-[2-(3-sulfonatopropoxy)ethoxy]ethoxy]ethoxy]phenoxy]ethoxy]ethoxy]ethoxy]propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCOCCOCCOCCOc1ccccc1OCCOCCOCCOCCCS(=O)(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C24H42O14S2.2K/c25-39(26,27)21-3-7-31-9-11-33-13-15-35-17-19-37-23-5-1-2-6-24(23)38-20-18-36-16-14-34-12-10-32-8-4-22-40(28,29)30;;/h1-2,5-6H,3-4,7-22H2,(H,25,26,27)(H,28,29,30);;/q;2*+1/p-2 |
| InChIKey | CLWCFMBCWLDWDW-UHFFFAOYSA-L |
| XLogP | -5.58 |
| TPSA | 188.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.90 |
| LogP ≤ 5 | -5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|