C11H15NaO4S — CID 87669395
sodium 4-phenylmethoxybutane-1-sulfonate (PubChem CID 87669395) has the molecular formula C11H15NaO4S and a molecular weight of 266.29 g/mol. Its IUPAC name is sodium 4-phenylmethoxybutane-1-sulfonate.
| Compound Name | sodium 4-phenylmethoxybutane-1-sulfonate |
|---|---|
| PubChem CID | 87669395 |
| Molecular Formula | C11H15NaO4S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | sodium 4-phenylmethoxybutane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCCOCc1ccccc1.[Na+] |
| InChI | InChI=1S/C11H16O4S.Na/c12-16(13,14)9-5-4-8-15-10-11-6-2-1-3-7-11;/h1-3,6-7H,4-5,8-10H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | VHVFUDAYQGAXOU-UHFFFAOYSA-M |
| XLogP | -1.47 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|