C16H14O5S2 — CID 57197634
3-(1-oxothioxanthen-2-yl)oxypropane-1-sulfonic acid (PubChem CID 57197634) has the molecular formula C16H14O5S2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-(1-oxothioxanthen-2-yl)oxypropane-1-sulfonic acid.
| Compound Name | 3-(1-oxothioxanthen-2-yl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 57197634 |
| Molecular Formula | C16H14O5S2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 3-(1-oxothioxanthen-2-yl)oxypropane-1-sulfonic acid |
| SMILES | O=c1c(OCCCS(=O)(=O)O)ccc2sc3ccccc3cc1-2 |
| InChI | InChI=1S/C16H14O5S2/c17-16-12-10-11-4-1-2-5-14(11)22-15(12)7-6-13(16)21-8-3-9-23(18,19)20/h1-2,4-7,10H,3,8-9H2,(H,18,19,20) |
| InChIKey | ZIOMVKUWSAKVOH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|