C24H27NO4S — CID 91212425
4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoic acid (PubChem CID 91212425) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is 4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoic acid.
| Compound Name | 4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 91212425 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1cc(-c2cc3ccccc3s2)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C24H27NO4S/c26-24(27)8-5-14-28-21-16-19(23-17-18-6-1-2-7-22(18)30-23)9-10-20(21)29-15-13-25-11-3-4-12-25/h1-2,6-7,9-10,16-17H,3-5,8,11-15H2,(H,26,27) |
| InChIKey | YJVRFUYDHUKXNY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|