C24H27N3O3S — CID 86597114
2-amino-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5-phenylthiophene-3-carboxamide (PubChem CID 86597114) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-amino-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5-phenylthiophene-3-carboxamide.
| Compound Name | 2-amino-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 86597114 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 2-amino-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-5-phenylthiophene-3-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(-c3ccccc3)sc2N)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C24H27N3O3S/c1-29-21-15-18(9-10-20(21)30-14-13-27-11-5-6-12-27)26-24(28)19-16-22(31-23(19)25)17-7-3-2-4-8-17/h2-4,7-10,15-16H,5-6,11-14,25H2,1H3,(H,26,28) |
| InChIKey | LKJCMVAHYWIYGO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |