C28H28Cl2N2O7S — CID 44528974
(Z)-but-2-enedioic acid;3-chloro-5-(4-chlorophenyl)-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide (PubChem CID 44528974) has the molecular formula C28H28Cl2N2O7S and a molecular weight of 607.51 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-chloro-5-(4-chlorophenyl)-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide.
| Compound Name | (Z)-but-2-enedioic acid;3-chloro-5-(4-chlorophenyl)-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 44528974 |
| Molecular Formula | C28H28Cl2N2O7S |
| Molecular Weight | 607.51 g/mol |
| Exact Mass | 606.10 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-chloro-5-(4-chlorophenyl)-N-[3-methoxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2sc(-c3ccc(Cl)cc3)cc2Cl)ccc1OCCN1CCCC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C24H24Cl2N2O3S.C4H4O4/c1-30-21-14-18(8-9-20(21)31-13-12-28-10-2-3-11-28)27-24(29)23-19(26)15-22(32-23)16-4-6-17(25)7-5-16;5-3(6)1-2-4(7)8/h4-9,14-15H,2-3,10-13H2,1H3,(H,27,29);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | GQKFMABFHLGGRD-BTJKTKAUSA-N |
| XLogP | 6.17 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|