C27H32ClN3O3S — CID 71206243
5-(4-chlorophenyl)-N-[3-methoxy-4-(3-piperidin-1-ylpropoxy)phenyl]-3-(methylamino)thiophene-2-carboxamide (PubChem CID 71206243) has the molecular formula C27H32ClN3O3S and a molecular weight of 514.09 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[3-methoxy-4-(3-piperidin-1-ylpropoxy)phenyl]-3-(methylamino)thiophene-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[3-methoxy-4-(3-piperidin-1-ylpropoxy)phenyl]-3-(methylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71206243 |
| Molecular Formula | C27H32ClN3O3S |
| Molecular Weight | 514.09 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[3-methoxy-4-(3-piperidin-1-ylpropoxy)phenyl]-3-(methylamino)thiophene-2-carboxamide |
| SMILES | CNc1cc(-c2ccc(Cl)cc2)sc1C(=O)Nc1ccc(OCCCN2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C27H32ClN3O3S/c1-29-22-18-25(19-7-9-20(28)10-8-19)35-26(22)27(32)30-21-11-12-23(24(17-21)33-2)34-16-6-15-31-13-4-3-5-14-31/h7-12,17-18,29H,3-6,13-16H2,1-2H3,(H,30,32) |
| InChIKey | MCVMHBHNJYUEFK-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.09 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|