C22H22N4O2S — CID 68603289
6-(1-benzothiophen-2-yl)-4-(2-morpholin-4-ylethoxy)quinazolin-2-amine (PubChem CID 68603289) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 6-(1-benzothiophen-2-yl)-4-(2-morpholin-4-ylethoxy)quinazolin-2-amine.
| Compound Name | 6-(1-benzothiophen-2-yl)-4-(2-morpholin-4-ylethoxy)quinazolin-2-amine |
|---|---|
| PubChem CID | 68603289 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 6-(1-benzothiophen-2-yl)-4-(2-morpholin-4-ylethoxy)quinazolin-2-amine |
| SMILES | Nc1nc(OCCN2CCOCC2)c2cc(-c3cc4ccccc4s3)ccc2n1 |
| InChI | InChI=1S/C22H22N4O2S/c23-22-24-18-6-5-16(20-14-15-3-1-2-4-19(15)29-20)13-17(18)21(25-22)28-12-9-26-7-10-27-11-8-26/h1-6,13-14H,7-12H2,(H2,23,24,25) |
| InChIKey | AFFLIFGCVLELSB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |