C26H31NO4S — CID 91317694
ethyl 4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoate (PubChem CID 91317694) has the molecular formula C26H31NO4S and a molecular weight of 453.60 g/mol. Its IUPAC name is ethyl 4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoate.
| Compound Name | ethyl 4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoate |
|---|---|
| PubChem CID | 91317694 |
| Molecular Formula | C26H31NO4S |
| Molecular Weight | 453.60 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | ethyl 4-[5-(1-benzothiophen-2-yl)-2-(2-pyrrolidin-1-ylethoxy)phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cc(-c2cc3ccccc3s2)ccc1OCCN1CCCC1 |
| InChI | InChI=1S/C26H31NO4S/c1-2-29-26(28)10-7-16-30-23-18-21(25-19-20-8-3-4-9-24(20)32-25)11-12-22(23)31-17-15-27-13-5-6-14-27/h3-4,8-9,11-12,18-19H,2,5-7,10,13-17H2,1H3 |
| InChIKey | ASNQRNGRAYJKLI-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|