C36H32FNO4S — CID 142064552
[5-[3-(4-fluorobenzoyl)-1-benzothiophen-2-yl]-2-(2-pyrrolidin-1-ylethoxy)phenyl] 4-ethylbenzoate (PubChem CID 142064552) has the molecular formula C36H32FNO4S and a molecular weight of 593.72 g/mol. Its IUPAC name is [5-[3-(4-fluorobenzoyl)-1-benzothiophen-2-yl]-2-(2-pyrrolidin-1-ylethoxy)phenyl] 4-ethylbenzoate.
| Compound Name | [5-[3-(4-fluorobenzoyl)-1-benzothiophen-2-yl]-2-(2-pyrrolidin-1-ylethoxy)phenyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 142064552 |
| Molecular Formula | C36H32FNO4S |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | [5-[3-(4-fluorobenzoyl)-1-benzothiophen-2-yl]-2-(2-pyrrolidin-1-ylethoxy)phenyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2cc(-c3sc4ccccc4c3C(=O)c3ccc(F)cc3)ccc2OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C36H32FNO4S/c1-2-24-9-11-26(12-10-24)36(40)42-31-23-27(15-18-30(31)41-22-21-38-19-5-6-20-38)35-33(29-7-3-4-8-32(29)43-35)34(39)25-13-16-28(37)17-14-25/h3-4,7-18,23H,2,5-6,19-22H2,1H3 |
| InChIKey | JIVMAYBBOKPHDO-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|