C24H19N3OS2 — CID 71481720
4-[4,6-bis(1-benzothiophen-2-yl)pyrimidin-2-yl]morpholine (PubChem CID 71481720) has the molecular formula C24H19N3OS2 and a molecular weight of 429.57 g/mol. Its IUPAC name is 4-[4,6-bis(1-benzothiophen-2-yl)pyrimidin-2-yl]morpholine.
| Compound Name | 4-[4,6-bis(1-benzothiophen-2-yl)pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 71481720 |
| Molecular Formula | C24H19N3OS2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 4-[4,6-bis(1-benzothiophen-2-yl)pyrimidin-2-yl]morpholine |
| SMILES | c1ccc2sc(-c3cc(-c4cc5ccccc5s4)nc(N4CCOCC4)n3)cc2c1 |
| InChI | InChI=1S/C24H19N3OS2/c1-3-7-20-16(5-1)13-22(29-20)18-15-19(23-14-17-6-2-4-8-21(17)30-23)26-24(25-18)27-9-11-28-12-10-27/h1-8,13-15H,9-12H2 |
| InChIKey | WXYOXOAEBGINAJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |