C14H6N2O2S — CID 141406311
2-(1-benzothiophen-2-yl)pyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 141406311) has the molecular formula C14H6N2O2S and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)pyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | 2-(1-benzothiophen-2-yl)pyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 141406311 |
| Molecular Formula | C14H6N2O2S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)pyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=c1nc2cc(-c3cc4ccccc4s3)nc-2c1=O |
| InChI | InChI=1S/C14H6N2O2S/c17-13-12-9(16-14(13)18)6-8(15-12)11-5-7-3-1-2-4-10(7)19-11/h1-6H |
| InChIKey | VHTBLBSVBSUMQT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|