C11H6BrNOS — CID 102974597
4-(1-benzothiophen-2-yl)-2-bromo-1,3-oxazole (PubChem CID 102974597) has the molecular formula C11H6BrNOS and a molecular weight of 280.15 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-yl)-2-bromo-1,3-oxazole.
| Compound Name | 4-(1-benzothiophen-2-yl)-2-bromo-1,3-oxazole |
|---|---|
| PubChem CID | 102974597 |
| Molecular Formula | C11H6BrNOS |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 278.94 |
| IUPAC Name | 4-(1-benzothiophen-2-yl)-2-bromo-1,3-oxazole |
| SMILES | Brc1nc(-c2cc3ccccc3s2)co1 |
| InChI | InChI=1S/C11H6BrNOS/c12-11-13-8(6-14-11)10-5-7-3-1-2-4-9(7)15-10/h1-6H |
| InChIKey | ZNDMUELNPLGDCY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |