C14H22O4S — CID 142364160
2-methyl-6-(4-methylphenoxy)hexane-1-sulfonic acid (PubChem CID 142364160) has the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. Its IUPAC name is 2-methyl-6-(4-methylphenoxy)hexane-1-sulfonic acid.
| Compound Name | 2-methyl-6-(4-methylphenoxy)hexane-1-sulfonic acid |
|---|---|
| PubChem CID | 142364160 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-methyl-6-(4-methylphenoxy)hexane-1-sulfonic acid |
| SMILES | Cc1ccc(OCCCCC(C)CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H22O4S/c1-12-6-8-14(9-7-12)18-10-4-3-5-13(2)11-19(15,16)17/h6-9,13H,3-5,10-11H2,1-2H3,(H,15,16,17) |
| InChIKey | JJGFNFHHNZTYGV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|