C12H18O4S — CID 142364176
3-methyl-4-(4-methylphenoxy)butane-2-sulfonic acid (PubChem CID 142364176) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-methyl-4-(4-methylphenoxy)butane-2-sulfonic acid.
| Compound Name | 3-methyl-4-(4-methylphenoxy)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 142364176 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-methyl-4-(4-methylphenoxy)butane-2-sulfonic acid |
| SMILES | Cc1ccc(OCC(C)C(C)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H18O4S/c1-9-4-6-12(7-5-9)16-8-10(2)11(3)17(13,14)15/h4-7,10-11H,8H2,1-3H3,(H,13,14,15) |
| InChIKey | LKJUGMYEQBYVBE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|