C33H25ClN10O10S3 — CID 142903191
1-amino-4-[4-[[4-chloro-6-(3-ethenylsulfonyl-N-ethylanilino)-1,3,5-triazin-2-yl]amino]-2-(trinitroso-λ4-sulfanyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid (PubChem CID 142903191) has the molecular formula C33H25ClN10O10S3 and a molecular weight of 853.28 g/mol. Its IUPAC name is 1-amino-4-[4-[[4-chloro-6-(3-ethenylsulfonyl-N-ethylanilino)-1,3,5-triazin-2-yl]amino]-2-(trinitroso-λ4-sulfanyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid.
| Compound Name | 1-amino-4-[4-[[4-chloro-6-(3-ethenylsulfonyl-N-ethylanilino)-1,3,5-triazin-2-yl]amino]-2-(trinitroso-λ4-sulfanyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| PubChem CID | 142903191 |
| Molecular Formula | C33H25ClN10O10S3 |
| Molecular Weight | 853.28 g/mol |
| Exact Mass | 852.06 |
| IUPAC Name | 1-amino-4-[4-[[4-chloro-6-(3-ethenylsulfonyl-N-ethylanilino)-1,3,5-triazin-2-yl]amino]-2-(trinitroso-λ4-sulfanyl)anilino]-9,10-dioxoanthracene-2-sulfonic acid |
| SMILES | C=CS(=O)(=O)c1cccc(N(CC)c2nc(Cl)nc(Nc3ccc(Nc4cc(S(=O)(=O)O)c(N)c5c4C(=O)c4ccccc4C5=O)c(S(N=O)(N=O)N=O)c3)n2)c1 |
| InChI | InChI=1S/C33H25ClN10O10S3/c1-3-44(18-8-7-9-19(15-18)55(50,51)4-2)33-39-31(34)38-32(40-33)36-17-12-13-22(24(14-17)56(41-47,42-48)43-49)37-23-16-25(57(52,53)54)28(35)27-26(23)29(45)20-10-5-6-11-21(20)30(27)46/h4-16,37H,2-3,35H2,1H3,(H,52,53,54)(H,36,38,39,40) |
| InChIKey | XOSSZYAIOOOPNB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 302.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.28 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|