C35H32ClN7O2 — CID 91380088
1-amino-4-[3-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]-2,4,5,6-tetramethylanilino]-2-methylanthracene-9,10-dione (PubChem CID 91380088) has the molecular formula C35H32ClN7O2 and a molecular weight of 618.14 g/mol. Its IUPAC name is 1-amino-4-[3-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]-2,4,5,6-tetramethylanilino]-2-methylanthracene-9,10-dione.
| Compound Name | 1-amino-4-[3-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]-2,4,5,6-tetramethylanilino]-2-methylanthracene-9,10-dione |
|---|---|
| PubChem CID | 91380088 |
| Molecular Formula | C35H32ClN7O2 |
| Molecular Weight | 618.14 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | 1-amino-4-[3-[[4-chloro-6-(3-methylanilino)-1,3,5-triazin-2-yl]amino]-2,4,5,6-tetramethylanilino]-2-methylanthracene-9,10-dione |
| SMILES | Cc1cccc(Nc2nc(Cl)nc(Nc3c(C)c(C)c(C)c(Nc4cc(C)c(N)c5c4C(=O)c4ccccc4C5=O)c3C)n2)c1 |
| InChI | InChI=1S/C35H32ClN7O2/c1-16-10-9-11-22(14-16)38-34-41-33(36)42-35(43-34)40-30-20(5)18(3)19(4)29(21(30)6)39-25-15-17(2)28(37)27-26(25)31(44)23-12-7-8-13-24(23)32(27)45/h7-15,39H,37H2,1-6H3,(H2,38,40,41,42,43) |
| InChIKey | YIJCITYPERQFEY-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.14 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|