C17H12NNaO8S2 — CID 164512225
sodium;hydron;4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonate (PubChem CID 164512225) has the molecular formula C17H12NNaO8S2 and a molecular weight of 445.41 g/mol. Its IUPAC name is sodium;hydron;4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonate.
| Compound Name | sodium;hydron;4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 164512225 |
| Molecular Formula | C17H12NNaO8S2 |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | sodium;hydron;4-hydroxy-5-[(2-hydroxyphenyl)methylideneamino]naphthalene-2,7-disulfonate |
| SMILES | O=S(=O)([O-])c1cc(O)c2c(/N=C/c3ccccc3O)cc(S(=O)(=O)[O-])cc2c1.[H+].[Na+] |
| InChI | InChI=1S/C17H13NO8S2.Na/c19-15-4-2-1-3-10(15)9-18-14-7-12(27(21,22)23)5-11-6-13(28(24,25)26)8-16(20)17(11)14;/h1-9,19-20H,(H,21,22,23)(H,24,25,26);/q;+1/p-1/b18-9+; |
| InChIKey | VDMRMECRCLGIAD-WUBZALIBSA-M |
| XLogP | -1.07 |
| TPSA | 167.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|