C17H17N5O7 — CID 135927147
4-(dimethylamino)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dinitrobenzamide (PubChem CID 135927147) has the molecular formula C17H17N5O7 and a molecular weight of 403.35 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dinitrobenzamide.
| Compound Name | 4-(dimethylamino)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 135927147 |
| Molecular Formula | C17H17N5O7 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-(dimethylamino)-N-[(Z)-(2-hydroxy-3-methoxyphenyl)methylideneamino]-3,5-dinitrobenzamide |
| SMILES | COc1cccc(/C=N\NC(=O)c2cc([N+](=O)[O-])c(N(C)C)c([N+](=O)[O-])c2)c1O |
| InChI | InChI=1S/C17H17N5O7/c1-20(2)15-12(21(25)26)7-11(8-13(15)22(27)28)17(24)19-18-9-10-5-4-6-14(29-3)16(10)23/h4-9,23H,1-3H3,(H,19,24)/b18-9- |
| InChIKey | QQDOJTCLCSJOIV-NVMNQCDNSA-N |
| XLogP | 2.05 |
| TPSA | 160.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|