About 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid
3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid (PubChem CID 142640106) has the molecular formula C14H11NO5
and a molecular weight of 273.24 g/mol. Its IUPAC name is 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid.
Molecular Properties
| Compound Name | 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid |
| PubChem CID | 142640106 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)c(/N=C/c2cccc(O)c2O)c1 |
| InChI | InChI=1S/C14H11NO5/c16-11-5-4-8(14(19)20)6-10(11)15-7-9-2-1-3-12(17)13(9)18/h1-7,16-18H,(H,19,20)/b15-7+ |
| InChIKey | LAXUBKMFSPIYQM-VIZOYTHASA-N |
| XLogP | 2.25 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid?
The IUPAC name of 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid (CID 142640106) is 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid.
What is the SMILES notation for 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid?
The canonical SMILES for 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid is O=C(O)c1ccc(O)c(/N=C/c2cccc(O)c2O)c1.
What is the InChIKey of 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid?
The InChIKey is LAXUBKMFSPIYQM-VIZOYTHASA-N. The full InChI is InChI=1S/C14H11NO5/c16-11-5-4-8(14(19)20)6-10(11)15-7-9-2-1-3-12(17)13(9)18/h1-7,16-18H,(H,19,20)/b15-7+.
What are the key properties of 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid?
3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid has a molecular weight of 273.24 g/mol, XLogP of 2.25, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid is sourced from PubChem (CID 142640106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).