C14H11NO5 — CID 142640106
3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid (PubChem CID 142640106) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid.
| Compound Name | 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 142640106 |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-[(2,3-dihydroxyphenyl)methylideneamino]-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)c(/N=C/c2cccc(O)c2O)c1 |
| InChI | InChI=1S/C14H11NO5/c16-11-5-4-8(14(19)20)6-10(11)15-7-9-2-1-3-12(17)13(9)18/h1-7,16-18H,(H,19,20)/b15-7+ |
| InChIKey | LAXUBKMFSPIYQM-VIZOYTHASA-N |
| XLogP | 2.25 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|