C27H19NO5 — CID 137213127
4-[4-(4-carboxyphenyl)-3-[(2-hydroxyphenyl)methylideneamino]phenyl]benzoic acid (PubChem CID 137213127) has the molecular formula C27H19NO5 and a molecular weight of 437.45 g/mol. Its IUPAC name is 4-[4-(4-carboxyphenyl)-3-[(2-hydroxyphenyl)methylideneamino]phenyl]benzoic acid.
| Compound Name | 4-[4-(4-carboxyphenyl)-3-[(2-hydroxyphenyl)methylideneamino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 137213127 |
| Molecular Formula | C27H19NO5 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 4-[4-(4-carboxyphenyl)-3-[(2-hydroxyphenyl)methylideneamino]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(-c3ccc(C(=O)O)cc3)c(/N=C/c3ccccc3O)c2)cc1 |
| InChI | InChI=1S/C27H19NO5/c29-25-4-2-1-3-22(25)16-28-24-15-21(17-5-9-19(10-6-17)26(30)31)13-14-23(24)18-7-11-20(12-8-18)27(32)33/h1-16,29H,(H,30,31)(H,32,33)/b28-16+ |
| InChIKey | PIVWXXFQWPFZQW-LQKURTRISA-N |
| XLogP | 5.87 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|