C30H35N3O5Zn — CID 139203412
zinc;2,4-ditert-butyl-6-[[4-nitro-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;ethanol (PubChem CID 139203412) has the molecular formula C30H35N3O5Zn and a molecular weight of 583.02 g/mol. Its IUPAC name is zinc;2,4-ditert-butyl-6-[[4-nitro-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;ethanol.
| Compound Name | zinc;2,4-ditert-butyl-6-[[4-nitro-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;ethanol |
|---|---|
| PubChem CID | 139203412 |
| Molecular Formula | C30H35N3O5Zn |
| Molecular Weight | 583.02 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | zinc;2,4-ditert-butyl-6-[[4-nitro-2-[(2-oxidophenyl)methylideneamino]phenyl]iminomethyl]phenolate;ethanol |
| SMILES | CC(C)(C)c1cc(/C=N/c2ccc([N+](=O)[O-])cc2/N=C/c2ccccc2[O-])c([O-])c(C(C)(C)C)c1.CCO.[Zn+2] |
| InChI | InChI=1S/C28H31N3O4.C2H6O.Zn/c1-27(2,3)20-13-19(26(33)22(14-20)28(4,5)6)17-29-23-12-11-21(31(34)35)15-24(23)30-16-18-9-7-8-10-25(18)32;1-2-3;/h7-17,32-33H,1-6H3;3H,2H2,1H3;/q;;+2/p-2/b29-17+,30-16+;; |
| InChIKey | LLYGNIRCMMRJNK-GMXZYZPMSA-L |
| XLogP | 5.83 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.02 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|