C51H52Zr — CID 173152271
cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-9H-fluoren-9-ide;1,3-dinaphthalen-1-ylpropan-2-ylidenezirconium(2+) (PubChem CID 173152271) has the molecular formula C51H52Zr and a molecular weight of 756.20 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-9H-fluoren-9-ide;1,3-dinaphthalen-1-ylpropan-2-ylidenezirconium(2+).
| Compound Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-9H-fluoren-9-ide;1,3-dinaphthalen-1-ylpropan-2-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 173152271 |
| Molecular Formula | C51H52Zr |
| Molecular Weight | 756.20 g/mol |
| Exact Mass | 754.31 |
| IUPAC Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-dimethyl-9H-fluoren-9-ide;1,3-dinaphthalen-1-ylpropan-2-ylidenezirconium(2+) |
| SMILES | Cc1cc2[cH-]c3cc(C)c(C(C)(C)C)cc3c2cc1C(C)(C)C.[C-]1=CC=CC1.[Zr+2]=C(Cc1cccc2ccccc12)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C23H18.C23H29.C5H5.Zr/c1-3-16-22-18(8-1)10-5-12-20(22)14-7-15-21-13-6-11-19-9-2-4-17-23(19)21;1-14-9-16-11-17-10-15(2)21(23(6,7)8)13-19(17)18(16)12-20(14)22(3,4)5;1-2-4-5-3-1;/h1-6,8-13,16-17H,14-15H2;9-13H,1-8H3;1-3H,4H2;/q;2*-1;+2 |
| InChIKey | AHAOCIUDMITSGQ-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.20 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|