C55H56Zr — CID 173135092
cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-bis(4-methylphenyl)-9H-fluoren-9-ide;1,3-diphenylpropan-2-ylidenezirconium(2+) (PubChem CID 173135092) has the molecular formula C55H56Zr and a molecular weight of 808.28 g/mol. Its IUPAC name is cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-bis(4-methylphenyl)-9H-fluoren-9-ide;1,3-diphenylpropan-2-ylidenezirconium(2+).
| Compound Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-bis(4-methylphenyl)-9H-fluoren-9-ide;1,3-diphenylpropan-2-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 173135092 |
| Molecular Formula | C55H56Zr |
| Molecular Weight | 808.28 g/mol |
| Exact Mass | 806.34 |
| IUPAC Name | cyclopenta-1,3-diene;3,6-ditert-butyl-2,7-bis(4-methylphenyl)-9H-fluoren-9-ide;1,3-diphenylpropan-2-ylidenezirconium(2+) |
| SMILES | Cc1ccc(-c2cc3[cH-]c4cc(-c5ccc(C)cc5)c(C(C)(C)C)cc4c3cc2C(C)(C)C)cc1.[C-]1=CC=CC1.[Zr+2]=C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C35H37.C15H14.C5H5.Zr/c1-22-9-13-24(14-10-22)30-18-26-17-27-19-31(25-15-11-23(2)12-16-25)33(35(6,7)8)21-29(27)28(26)20-32(30)34(3,4)5;1-3-8-14(9-4-1)12-7-13-15-10-5-2-6-11-15;1-2-4-5-3-1;/h9-21H,1-8H3;1-6,8-11H,12-13H2;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | VTYRTMVXRLRVJM-UHFFFAOYSA-N |
| XLogP | 14.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.28 |
| LogP ≤ 5 | 14.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|