C11H11F3LiNO2 — CID 59439423
lithium 3-[(dimethylamino)methyl]-5-(trifluoromethyl)benzoate (PubChem CID 59439423) has the molecular formula C11H11F3LiNO2 and a molecular weight of 253.15 g/mol. Its IUPAC name is lithium 3-[(dimethylamino)methyl]-5-(trifluoromethyl)benzoate.
| Compound Name | lithium 3-[(dimethylamino)methyl]-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 59439423 |
| Molecular Formula | C11H11F3LiNO2 |
| Molecular Weight | 253.15 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | lithium 3-[(dimethylamino)methyl]-5-(trifluoromethyl)benzoate |
| SMILES | CN(C)Cc1cc(C(=O)[O-])cc(C(F)(F)F)c1.[Li+] |
| InChI | InChI=1S/C11H12F3NO2.Li/c1-15(2)6-7-3-8(10(16)17)5-9(4-7)11(12,13)14;/h3-5H,6H2,1-2H3,(H,16,17);/q;+1/p-1 |
| InChIKey | JBKWQWOJZNWRDO-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.15 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |