C9H5ClF3O3S- — CID 174741946
[3-carbonochloridoyl-5-(trifluoromethyl)phenyl]methanesulfinate (PubChem CID 174741946) has the molecular formula C9H5ClF3O3S- and a molecular weight of 285.65 g/mol. Its IUPAC name is [3-carbonochloridoyl-5-(trifluoromethyl)phenyl]methanesulfinate.
| Compound Name | [3-carbonochloridoyl-5-(trifluoromethyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174741946 |
| Molecular Formula | C9H5ClF3O3S- |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 284.96 |
| IUPAC Name | [3-carbonochloridoyl-5-(trifluoromethyl)phenyl]methanesulfinate |
| SMILES | O=C(Cl)c1cc(CS(=O)[O-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6ClF3O3S/c10-8(14)6-1-5(4-17(15)16)2-7(3-6)9(11,12)13/h1-3H,4H2,(H,15,16)/p-1 |
| InChIKey | OUGPBPIINUROTP-UHFFFAOYSA-M |
| XLogP | 2.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|