C11H7F3NO3S- — CID 174731185
[2-(2-cyanoacetyl)-5-(trifluoromethyl)phenyl]methanesulfinate (PubChem CID 174731185) has the molecular formula C11H7F3NO3S- and a molecular weight of 290.24 g/mol. Its IUPAC name is [2-(2-cyanoacetyl)-5-(trifluoromethyl)phenyl]methanesulfinate.
| Compound Name | [2-(2-cyanoacetyl)-5-(trifluoromethyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174731185 |
| Molecular Formula | C11H7F3NO3S- |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | [2-(2-cyanoacetyl)-5-(trifluoromethyl)phenyl]methanesulfinate |
| SMILES | N#CCC(=O)c1ccc(C(F)(F)F)cc1CS(=O)[O-] |
| InChI | InChI=1S/C11H8F3NO3S/c12-11(13,14)8-1-2-9(10(16)3-4-15)7(5-8)6-19(17)18/h1-2,5H,3,6H2,(H,17,18)/p-1 |
| InChIKey | DDMVEYVVOUGBGH-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 80.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|