C19H14F3NO5S — CID 174731412
[2-(2-cyano-3-oxo-3-phenylmethoxypropanoyl)-5-(trifluoromethyl)phenyl]methanesulfinic acid (PubChem CID 174731412) has the molecular formula C19H14F3NO5S and a molecular weight of 425.38 g/mol. Its IUPAC name is [2-(2-cyano-3-oxo-3-phenylmethoxypropanoyl)-5-(trifluoromethyl)phenyl]methanesulfinic acid.
| Compound Name | [2-(2-cyano-3-oxo-3-phenylmethoxypropanoyl)-5-(trifluoromethyl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174731412 |
| Molecular Formula | C19H14F3NO5S |
| Molecular Weight | 425.38 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [2-(2-cyano-3-oxo-3-phenylmethoxypropanoyl)-5-(trifluoromethyl)phenyl]methanesulfinic acid |
| SMILES | N#CC(C(=O)OCc1ccccc1)C(=O)c1ccc(C(F)(F)F)cc1CS(=O)O |
| InChI | InChI=1S/C19H14F3NO5S/c20-19(21,22)14-6-7-15(13(8-14)11-29(26)27)17(24)16(9-23)18(25)28-10-12-4-2-1-3-5-12/h1-8,16H,10-11H2,(H,26,27) |
| InChIKey | INSJNCFHUWAQBD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|