C10H8Na2O9S — CID 87724499
disodium;5-(1,1-dihydroxyethoxysulfonyl)benzene-1,3-dicarboxylate (PubChem CID 87724499) has the molecular formula C10H8Na2O9S and a molecular weight of 350.21 g/mol. Its IUPAC name is disodium;5-(1,1-dihydroxyethoxysulfonyl)benzene-1,3-dicarboxylate.
| Compound Name | disodium;5-(1,1-dihydroxyethoxysulfonyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 87724499 |
| Molecular Formula | C10H8Na2O9S |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | disodium;5-(1,1-dihydroxyethoxysulfonyl)benzene-1,3-dicarboxylate |
| SMILES | CC(O)(O)OS(=O)(=O)c1cc(C(=O)[O-])cc(C(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C10H10O9S.2Na/c1-10(15,16)19-20(17,18)7-3-5(8(11)12)2-6(4-7)9(13)14;;/h2-4,15-16H,1H3,(H,11,12)(H,13,14);;/q;2*+1/p-2 |
| InChIKey | JVTKUBUNBQTKLN-UHFFFAOYSA-L |
| XLogP | -9.21 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | -9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|