C18H28N2O — CID 56624221
2,6-ditert-butyl-4-(2-methyl-2,4-dihydroimidazol-3-yl)phenol (PubChem CID 56624221) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-(2-methyl-2,4-dihydroimidazol-3-yl)phenol.
| Compound Name | 2,6-ditert-butyl-4-(2-methyl-2,4-dihydroimidazol-3-yl)phenol |
|---|---|
| PubChem CID | 56624221 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2,6-ditert-butyl-4-(2-methyl-2,4-dihydroimidazol-3-yl)phenol |
| SMILES | CC1N=CCN1c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H28N2O/c1-12-19-8-9-20(12)13-10-14(17(2,3)4)16(21)15(11-13)18(5,6)7/h8,10-12,21H,9H2,1-7H3 |
| InChIKey | XEQFIRMCCQTLCG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |